C22H25ClN4O — CID 167484683
2-chloro-N-[3-[1H-imidazol-5-ylmethyl(methyl)amino]phenyl]-N-(2-methylpropyl)benzamide (PubChem CID 167484683) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 2-chloro-N-[3-[1H-imidazol-5-ylmethyl(methyl)amino]phenyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-chloro-N-[3-[1H-imidazol-5-ylmethyl(methyl)amino]phenyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 167484683 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-chloro-N-[3-[1H-imidazol-5-ylmethyl(methyl)amino]phenyl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(C(=O)c1ccccc1Cl)c1cccc(N(C)Cc2cnc[nH]2)c1 |
| InChI | InChI=1S/C22H25ClN4O/c1-16(2)13-27(22(28)20-9-4-5-10-21(20)23)19-8-6-7-18(11-19)26(3)14-17-12-24-15-25-17/h4-12,15-16H,13-14H2,1-3H3,(H,24,25) |
| InChIKey | OONYYTZQUUEZTR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |