C22H26ClNO4 — CID 86195756
6-(N-(2-chlorobenzoyl)-3-propan-2-yloxyanilino)hexanoic acid (PubChem CID 86195756) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 6-(N-(2-chlorobenzoyl)-3-propan-2-yloxyanilino)hexanoic acid.
| Compound Name | 6-(N-(2-chlorobenzoyl)-3-propan-2-yloxyanilino)hexanoic acid |
|---|---|
| PubChem CID | 86195756 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 6-(N-(2-chlorobenzoyl)-3-propan-2-yloxyanilino)hexanoic acid |
| SMILES | CC(C)Oc1cccc(N(CCCCCC(=O)O)C(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H26ClNO4/c1-16(2)28-18-10-8-9-17(15-18)24(14-7-3-4-13-21(25)26)22(27)19-11-5-6-12-20(19)23/h5-6,8-12,15-16H,3-4,7,13-14H2,1-2H3,(H,25,26) |
| InChIKey | WXWROHCARYXBML-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|