C14H16FN3O — CID 167484753
fluorobenzene;1H-imidazol-5-yl(pyrrolidin-1-yl)methanone (PubChem CID 167484753) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is fluorobenzene;1H-imidazol-5-yl(pyrrolidin-1-yl)methanone.
| Compound Name | fluorobenzene;1H-imidazol-5-yl(pyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 167484753 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | fluorobenzene;1H-imidazol-5-yl(pyrrolidin-1-yl)methanone |
| SMILES | Fc1ccccc1.O=C(c1cnc[nH]1)N1CCCC1 |
| InChI | InChI=1S/C8H11N3O.C6H5F/c12-8(7-5-9-6-10-7)11-3-1-2-4-11;7-6-4-2-1-3-5-6/h5-6H,1-4H2,(H,9,10);1-5H |
| InChIKey | WIUNHERLXYIQLD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |