C22H23ClFNO4 — CID 167488516
methyl 2-[[5-chloro-4-(cyclopentylmethoxy)-2-fluorobenzoyl]amino]-2-phenylacetate (PubChem CID 167488516) has the molecular formula C22H23ClFNO4 and a molecular weight of 419.88 g/mol. Its IUPAC name is methyl 2-[[5-chloro-4-(cyclopentylmethoxy)-2-fluorobenzoyl]amino]-2-phenylacetate.
| Compound Name | methyl 2-[[5-chloro-4-(cyclopentylmethoxy)-2-fluorobenzoyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 167488516 |
| Molecular Formula | C22H23ClFNO4 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl 2-[[5-chloro-4-(cyclopentylmethoxy)-2-fluorobenzoyl]amino]-2-phenylacetate |
| SMILES | COC(=O)C(NC(=O)c1cc(Cl)c(OCC2CCCC2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C22H23ClFNO4/c1-28-22(27)20(15-9-3-2-4-10-15)25-21(26)16-11-17(23)19(12-18(16)24)29-13-14-7-5-6-8-14/h2-4,9-12,14,20H,5-8,13H2,1H3,(H,25,26) |
| InChIKey | LPGQGMGFICRCLK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |