C17H21N3S — CID 167488887
2-anilino-N'-(2-phenylsulfanylpropyl)ethanimidamide (PubChem CID 167488887) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-anilino-N'-(2-phenylsulfanylpropyl)ethanimidamide.
| Compound Name | 2-anilino-N'-(2-phenylsulfanylpropyl)ethanimidamide |
|---|---|
| PubChem CID | 167488887 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-anilino-N'-(2-phenylsulfanylpropyl)ethanimidamide |
| SMILES | CC(C/N=C(\N)CNc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C17H21N3S/c1-14(21-16-10-6-3-7-11-16)12-20-17(18)13-19-15-8-4-2-5-9-15/h2-11,14,19H,12-13H2,1H3,(H2,18,20) |
| InChIKey | HJMDKXRTJPBJCT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|