C21H31N5O3 — CID 16748898
(3R)-6-cyclohexyl-3-[3-[6-(dimethylamino)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide (PubChem CID 16748898) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-3-[3-[6-(dimethylamino)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide.
| Compound Name | (3R)-6-cyclohexyl-3-[3-[6-(dimethylamino)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 16748898 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (3R)-6-cyclohexyl-3-[3-[6-(dimethylamino)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-N-hydroxyhexanamide |
| SMILES | CN(C)c1ccc(-c2noc([C@H](CCCC3CCCCC3)CC(=O)NO)n2)cn1 |
| InChI | InChI=1S/C21H31N5O3/c1-26(2)18-12-11-17(14-22-18)20-23-21(29-25-20)16(13-19(27)24-28)10-6-9-15-7-4-3-5-8-15/h11-12,14-16,28H,3-10,13H2,1-2H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | XGZATWGYFADJDC-MRXNPFEDSA-N |
| XLogP | 3.93 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|