C17H22FNO3S — CID 167489198
[1-[3-fluoro-4-(2-methoxyethoxy)phenyl]-4,4-dimethyl-1-oxopentan-2-yl] thiocyanate (PubChem CID 167489198) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is [1-[3-fluoro-4-(2-methoxyethoxy)phenyl]-4,4-dimethyl-1-oxopentan-2-yl] thiocyanate.
| Compound Name | [1-[3-fluoro-4-(2-methoxyethoxy)phenyl]-4,4-dimethyl-1-oxopentan-2-yl] thiocyanate |
|---|---|
| PubChem CID | 167489198 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [1-[3-fluoro-4-(2-methoxyethoxy)phenyl]-4,4-dimethyl-1-oxopentan-2-yl] thiocyanate |
| SMILES | COCCOc1ccc(C(=O)C(CC(C)(C)C)SC#N)cc1F |
| InChI | InChI=1S/C17H22FNO3S/c1-17(2,3)10-15(23-11-19)16(20)12-5-6-14(13(18)9-12)22-8-7-21-4/h5-6,9,15H,7-8,10H2,1-4H3 |
| InChIKey | CVZFSGVJLQIXBR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|