C22H21BF3N3O2S — CID 167489882
CID 167489882 (PubChem CID 167489882) has the molecular formula C22H21BF3N3O2S and a molecular weight of 459.30 g/mol.
| Compound Name | CID 167489882 |
|---|---|
| PubChem CID | 167489882 |
| Molecular Formula | C22H21BF3N3O2S |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2sc(Nc3ncc(C(F)(F)F)cc3C(=O)OC)nc2CCC(C)C)cc1 |
| InChI | InChI=1S/C22H21BF3N3O2S/c1-12(2)4-9-17-18(13-5-7-15(23)8-6-13)32-21(28-17)29-19-16(20(30)31-3)10-14(11-27-19)22(24,25)26/h5-8,10-12H,4,9H2,1-3H3,(H,27,28,29) |
| InChIKey | KUAXWHKZMQVNLL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|