C29H49F3O2 — CID 167490583
(1S,2S,5R,8S,11R,12S,15R,16R)-5-ethyl-2,16-dimethyl-15-[(2R,5R)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadecan-5-ol (PubChem CID 167490583) has the molecular formula C29H49F3O2 and a molecular weight of 486.70 g/mol. Its IUPAC name is (1S,2S,5R,8S,11R,12S,15R,16R)-5-ethyl-2,16-dimethyl-15-[(2R,5R)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadecan-5-ol.
| Compound Name | (1S,2S,5R,8S,11R,12S,15R,16R)-5-ethyl-2,16-dimethyl-15-[(2R,5R)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadecan-5-ol |
|---|---|
| PubChem CID | 167490583 |
| Molecular Formula | C29H49F3O2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (1S,2S,5R,8S,11R,12S,15R,16R)-5-ethyl-2,16-dimethyl-15-[(2R,5R)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadecan-5-ol |
| SMILES | CC[C@@]1(O)CC[C@@H]2CC[C@@H]3[C@H](CC[C@]4(C)[C@@H]([C@H](C)CC[C@@](C)(O)C(F)(F)F)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C29H49F3O2/c1-6-28(34)16-12-20-7-8-21-23-10-9-22(19(2)11-15-27(5,33)29(30,31)32)26(23,4)14-13-24(21)25(20,3)17-18-28/h19-24,33-34H,6-18H2,1-5H3/t19-,20+,21+,22-,23+,24+,25+,26-,27-,28-/m1/s1 |
| InChIKey | MVSWTAQJZTUYAR-BDYTWXPRSA-N |
| XLogP | 7.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |