C23H36O2 — CID 167490657
1-[(1S,2R,5R,8R,10S,11S,14S,15S)-15-ethyl-8-methoxy-2-methyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethanone (PubChem CID 167490657) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 1-[(1S,2R,5R,8R,10S,11S,14S,15S)-15-ethyl-8-methoxy-2-methyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethanone.
| Compound Name | 1-[(1S,2R,5R,8R,10S,11S,14S,15S)-15-ethyl-8-methoxy-2-methyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethanone |
|---|---|
| PubChem CID | 167490657 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 1-[(1S,2R,5R,8R,10S,11S,14S,15S)-15-ethyl-8-methoxy-2-methyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]ethanone |
| SMILES | CC[C@]12CC[C@H]3[C@@H](C[C@@H](OC)C45C[C@H]4CC[C@]35C)[C@@H]1CC[C@@H]2C(C)=O |
| InChI | InChI=1S/C23H36O2/c1-5-22-11-9-18-16(19(22)7-6-17(22)14(2)24)12-20(25-4)23-13-15(23)8-10-21(18,23)3/h15-20H,5-13H2,1-4H3/t15-,16-,17-,18+,19+,20-,21-,22-,23?/m1/s1 |
| InChIKey | IEOWJTZJMLSMLI-KHVHKFBQSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |