C16H23F3N6O3Si — CID 167491424
(2R,3R,4R,5S)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-[(4-trimethylsilyltriazol-1-yl)methyl]oxane-3,4-diol (PubChem CID 167491424) has the molecular formula C16H23F3N6O3Si and a molecular weight of 432.48 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-[(4-trimethylsilyltriazol-1-yl)methyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-[(4-trimethylsilyltriazol-1-yl)methyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 167491424 |
| Molecular Formula | C16H23F3N6O3Si |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (2R,3R,4R,5S)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-[(4-trimethylsilyltriazol-1-yl)methyl]oxane-3,4-diol |
| SMILES | C[Si](C)(C)c1cn(C[C@H]2OC[C@H](Nc3nccc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C16H23F3N6O3Si/c1-29(2,3)12-7-25(24-23-12)6-10-14(27)13(26)9(8-28-10)21-15-20-5-4-11(22-15)16(17,18)19/h4-5,7,9-10,13-14,26-27H,6,8H2,1-3H3,(H,20,21,22)/t9-,10+,13+,14-/m0/s1 |
| InChIKey | QHEMXQHXXUROOC-PJQZNRQZSA-N |
| XLogP | 0.23 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|