2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium

C7H18NO5PV — CID 167492403

IUPAC2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium
SMILESCOP(O)OCCOCCOCCN.[V]
InChIInChI=1S/C7H18NO5P.V/c1-10-14(9)13-7-6-12-5-4-11-3-2-8;/h9H,2-8H2,1H3;
InChIKeyAVVOVIMNBSVHLP-UHFFFAOYSA-N
MW278.14 g/mol
LogP-0.14
Rot. Bonds10

About 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium

2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium (PubChem CID 167492403) has the molecular formula C7H18NO5PV and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium.

Molecular Properties

Compound Name2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium
PubChem CID167492403
Molecular FormulaC7H18NO5PV
Molecular Weight278.14 g/mol
Exact Mass278.04
IUPAC Name2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium
SMILESCOP(O)OCCOCCOCCN.[V]
InChIInChI=1S/C7H18NO5P.V/c1-10-14(9)13-7-6-12-5-4-11-3-2-8;/h9H,2-8H2,1H3;
InChIKeyAVVOVIMNBSVHLP-UHFFFAOYSA-N
XLogP-0.14
TPSA83.17 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.14
LogP ≤ 5-0.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
The IUPAC name of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium (CID 167492403) is 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium.
What is the SMILES notation for 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
The canonical SMILES for 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium is COP(O)OCCOCCOCCN.[V].
What is the InChIKey of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
The InChIKey is AVVOVIMNBSVHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18NO5P.V/c1-10-14(9)13-7-6-12-5-4-11-3-2-8;/h9H,2-8H2,1H3;.
What are the key properties of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium has a molecular weight of 278.14 g/mol, XLogP of -0.14, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium is sourced from PubChem (CID 167492403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).