About 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium
2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium (PubChem CID 167492403) has the molecular formula C7H18NO5PV
and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium.
Molecular Properties
| Compound Name | 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium |
| PubChem CID | 167492403 |
| Molecular Formula | C7H18NO5PV |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium |
| SMILES | COP(O)OCCOCCOCCN.[V] |
| InChI | InChI=1S/C7H18NO5P.V/c1-10-14(9)13-7-6-12-5-4-11-3-2-8;/h9H,2-8H2,1H3; |
| InChIKey | AVVOVIMNBSVHLP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
The IUPAC name of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium (CID 167492403) is 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium.
What is the SMILES notation for 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
The canonical SMILES for 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium is COP(O)OCCOCCOCCN.[V].
What is the InChIKey of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
The InChIKey is AVVOVIMNBSVHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18NO5P.V/c1-10-14(9)13-7-6-12-5-4-11-3-2-8;/h9H,2-8H2,1H3;.
What are the key properties of 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium?
2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium has a molecular weight of 278.14 g/mol, XLogP of -0.14, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium is sourced from PubChem (CID 167492403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).