2-hydroxyethyl methyl hydrogen phosphite

C3H9O4P — CID 23415062

IUPAC2-hydroxyethyl methyl hydrogen phosphite
SMILESCOP(O)OCCO
InChIInChI=1S/C3H9O4P/c1-6-8(5)7-3-2-4/h4-5H,2-3H2,1H3
InChIKeyUFLKNNDAAGEHKM-UHFFFAOYSA-N
MW140.07 g/mol
LogP-0.14
Rot. Bonds4

About 2-hydroxyethyl methyl hydrogen phosphite

2-hydroxyethyl methyl hydrogen phosphite (PubChem CID 23415062) has the molecular formula C3H9O4P and a molecular weight of 140.07 g/mol. Its IUPAC name is 2-hydroxyethyl methyl hydrogen phosphite.

Molecular Properties

Compound Name2-hydroxyethyl methyl hydrogen phosphite
PubChem CID23415062
Molecular FormulaC3H9O4P
Molecular Weight140.07 g/mol
Exact Mass140.02
IUPAC Name2-hydroxyethyl methyl hydrogen phosphite
SMILESCOP(O)OCCO
InChIInChI=1S/C3H9O4P/c1-6-8(5)7-3-2-4/h4-5H,2-3H2,1H3
InChIKeyUFLKNNDAAGEHKM-UHFFFAOYSA-N
XLogP-0.14
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.07
LogP ≤ 5-0.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-hydroxyethyl methyl hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-hydroxyethyl dimethyl phosphite
CID 23414613
hexyl methyl hydrogen phosphite
CID 22731198
azane;ethyl methyl hydrogen phosphite
CID 173447260
2-[2-(2-aminoethoxy)ethoxy]ethyl methyl hydrogen phosphite;vanadium
CID 167492403
sodium 2-methoxyethanol
CID 21124383
lithium;dimethyl hydrogen phosphite;hydride
CID 173436739
sodium;methanolate;2-methoxyethanol
CID 88740806
4-hydroxybutyl tridecyl hydrogen phosphite
CID 154235409
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl hypochlorite
CID 174668360
2-methoxyethanol;sulfane
CID 174965249
ethane;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol
CID 159638520
2-(2-hydroxyethylperoxy)ethanol;methoxymethane
CID 174905336

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyethyl methyl hydrogen phosphite?
The IUPAC name of 2-hydroxyethyl methyl hydrogen phosphite (CID 23415062) is 2-hydroxyethyl methyl hydrogen phosphite.
What is the SMILES notation for 2-hydroxyethyl methyl hydrogen phosphite?
The canonical SMILES for 2-hydroxyethyl methyl hydrogen phosphite is COP(O)OCCO.
What is the InChIKey of 2-hydroxyethyl methyl hydrogen phosphite?
The InChIKey is UFLKNNDAAGEHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O4P/c1-6-8(5)7-3-2-4/h4-5H,2-3H2,1H3.
What are the key properties of 2-hydroxyethyl methyl hydrogen phosphite?
2-hydroxyethyl methyl hydrogen phosphite has a molecular weight of 140.07 g/mol, XLogP of -0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl methyl hydrogen phosphite is sourced from PubChem (CID 23415062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).