About 2-hydroxyethyl methyl hydrogen phosphite
2-hydroxyethyl methyl hydrogen phosphite (PubChem CID 23415062) has the molecular formula C3H9O4P
and a molecular weight of 140.07 g/mol. Its IUPAC name is 2-hydroxyethyl methyl hydrogen phosphite.
Molecular Properties
| Compound Name | 2-hydroxyethyl methyl hydrogen phosphite |
| PubChem CID | 23415062 |
| Molecular Formula | C3H9O4P |
| Molecular Weight | 140.07 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 2-hydroxyethyl methyl hydrogen phosphite |
| SMILES | COP(O)OCCO |
| InChI | InChI=1S/C3H9O4P/c1-6-8(5)7-3-2-4/h4-5H,2-3H2,1H3 |
| InChIKey | UFLKNNDAAGEHKM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.07 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl methyl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl methyl hydrogen phosphite?
The IUPAC name of 2-hydroxyethyl methyl hydrogen phosphite (CID 23415062) is 2-hydroxyethyl methyl hydrogen phosphite.
What is the SMILES notation for 2-hydroxyethyl methyl hydrogen phosphite?
The canonical SMILES for 2-hydroxyethyl methyl hydrogen phosphite is COP(O)OCCO.
What is the InChIKey of 2-hydroxyethyl methyl hydrogen phosphite?
The InChIKey is UFLKNNDAAGEHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O4P/c1-6-8(5)7-3-2-4/h4-5H,2-3H2,1H3.
What are the key properties of 2-hydroxyethyl methyl hydrogen phosphite?
2-hydroxyethyl methyl hydrogen phosphite has a molecular weight of 140.07 g/mol, XLogP of -0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl methyl hydrogen phosphite is sourced from PubChem (CID 23415062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).