About azane;ethyl methyl hydrogen phosphite
azane;ethyl methyl hydrogen phosphite (PubChem CID 173447260) has the molecular formula C3H12NO3P
and a molecular weight of 141.11 g/mol. Its IUPAC name is azane;ethyl methyl hydrogen phosphite.
Molecular Properties
| Compound Name | azane;ethyl methyl hydrogen phosphite |
| PubChem CID | 173447260 |
| Molecular Formula | C3H12NO3P |
| Molecular Weight | 141.11 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | azane;ethyl methyl hydrogen phosphite |
| SMILES | CCOP(O)OC.N |
| InChI | InChI=1S/C3H9O3P.H3N/c1-3-6-7(4)5-2;/h4H,3H2,1-2H3;1H3 |
| InChIKey | ANFGOQWEOVCOPW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl methyl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl methyl hydrogen phosphite?
The IUPAC name of azane;ethyl methyl hydrogen phosphite (CID 173447260) is azane;ethyl methyl hydrogen phosphite.
What is the SMILES notation for azane;ethyl methyl hydrogen phosphite?
The canonical SMILES for azane;ethyl methyl hydrogen phosphite is CCOP(O)OC.N.
What is the InChIKey of azane;ethyl methyl hydrogen phosphite?
The InChIKey is ANFGOQWEOVCOPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O3P.H3N/c1-3-6-7(4)5-2;/h4H,3H2,1-2H3;1H3.
What are the key properties of azane;ethyl methyl hydrogen phosphite?
azane;ethyl methyl hydrogen phosphite has a molecular weight of 141.11 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl methyl hydrogen phosphite is sourced from PubChem (CID 173447260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).