azane;ethyl methyl hydrogen phosphite

C3H12NO3P — CID 173447260

IUPACazane;ethyl methyl hydrogen phosphite
SMILESCCOP(O)OC.N
InChIInChI=1S/C3H9O3P.H3N/c1-3-6-7(4)5-2;/h4H,3H2,1-2H3;1H3
InChIKeyANFGOQWEOVCOPW-UHFFFAOYSA-N
MW141.11 g/mol
LogP1.05
Rot. Bonds3

About azane;ethyl methyl hydrogen phosphite

azane;ethyl methyl hydrogen phosphite (PubChem CID 173447260) has the molecular formula C3H12NO3P and a molecular weight of 141.11 g/mol. Its IUPAC name is azane;ethyl methyl hydrogen phosphite.

Molecular Properties

Compound Nameazane;ethyl methyl hydrogen phosphite
PubChem CID173447260
Molecular FormulaC3H12NO3P
Molecular Weight141.11 g/mol
Exact Mass141.06
IUPAC Nameazane;ethyl methyl hydrogen phosphite
SMILESCCOP(O)OC.N
InChIInChI=1S/C3H9O3P.H3N/c1-3-6-7(4)5-2;/h4H,3H2,1-2H3;1H3
InChIKeyANFGOQWEOVCOPW-UHFFFAOYSA-N
XLogP1.05
TPSA73.69 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.11
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze azane;ethyl methyl hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

diethyl hydrogen phosphite
CID 12977
diethyl hydrogen phosphite;mercury
CID 54602640
2-hydroxyethyl methyl hydrogen phosphite
CID 23415062
hexyl methyl hydrogen phosphite
CID 22731198
acetic acid;diethyl hydrogen phosphite;mercury
CID 21535
bromoethene;diethyl hydrogen phosphite
CID 88780762
lithium;dimethyl hydrogen phosphite;hydride
CID 173436739
phosphorous acid;triethyl phosphite
CID 174300225
ethyl dihydrogen phosphite;dihydrochloride
CID 88746637
diethyl hydrogen phosphite;toluene
CID 162138652
disodium;carbon monoxide;diethoxyphosphane;diethyl hydrogen phosphite;manganese
CID 11114554
[amino(methoxy)phosphanyl]oxyethane
CID 89006089

Frequently Asked Questions

What is the IUPAC name of azane;ethyl methyl hydrogen phosphite?
The IUPAC name of azane;ethyl methyl hydrogen phosphite (CID 173447260) is azane;ethyl methyl hydrogen phosphite.
What is the SMILES notation for azane;ethyl methyl hydrogen phosphite?
The canonical SMILES for azane;ethyl methyl hydrogen phosphite is CCOP(O)OC.N.
What is the InChIKey of azane;ethyl methyl hydrogen phosphite?
The InChIKey is ANFGOQWEOVCOPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9O3P.H3N/c1-3-6-7(4)5-2;/h4H,3H2,1-2H3;1H3.
What are the key properties of azane;ethyl methyl hydrogen phosphite?
azane;ethyl methyl hydrogen phosphite has a molecular weight of 141.11 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl methyl hydrogen phosphite is sourced from PubChem (CID 173447260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).