diethyl hydrogen phosphite;mercury

C4H11HgO3P — CID 54602640

IUPACdiethyl hydrogen phosphite;mercury
SMILESCCOP(O)OCC.[Hg]
InChIInChI=1S/C4H11O3P.Hg/c1-3-6-8(5)7-4-2;/h5H,3-4H2,1-2H3;
InChIKeyQBLIKRRPMSIEIA-UHFFFAOYSA-N
MW338.69 g/mol
LogP1.28
Rot. Bonds4

About diethyl hydrogen phosphite;mercury

diethyl hydrogen phosphite;mercury (PubChem CID 54602640) has the molecular formula C4H11HgO3P and a molecular weight of 338.69 g/mol. Its IUPAC name is diethyl hydrogen phosphite;mercury.

Molecular Properties

Compound Namediethyl hydrogen phosphite;mercury
PubChem CID54602640
Molecular FormulaC4H11HgO3P
Molecular Weight338.69 g/mol
Exact Mass340.02
IUPAC Namediethyl hydrogen phosphite;mercury
SMILESCCOP(O)OCC.[Hg]
InChIInChI=1S/C4H11O3P.Hg/c1-3-6-8(5)7-4-2;/h5H,3-4H2,1-2H3;
InChIKeyQBLIKRRPMSIEIA-UHFFFAOYSA-N
XLogP1.28
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.69
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze diethyl hydrogen phosphite;mercury with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl hydrogen phosphite;mercury?
The IUPAC name of diethyl hydrogen phosphite;mercury (CID 54602640) is diethyl hydrogen phosphite;mercury.
What is the SMILES notation for diethyl hydrogen phosphite;mercury?
The canonical SMILES for diethyl hydrogen phosphite;mercury is CCOP(O)OCC.[Hg].
What is the InChIKey of diethyl hydrogen phosphite;mercury?
The InChIKey is QBLIKRRPMSIEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11O3P.Hg/c1-3-6-8(5)7-4-2;/h5H,3-4H2,1-2H3;.
What are the key properties of diethyl hydrogen phosphite;mercury?
diethyl hydrogen phosphite;mercury has a molecular weight of 338.69 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl hydrogen phosphite;mercury is sourced from PubChem (CID 54602640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).