C29H41F4N3 — CID 167492858
ethane;5-[2-(1-fluoroethyl)-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine;2-methyloctane (PubChem CID 167492858) has the molecular formula C29H41F4N3 and a molecular weight of 507.66 g/mol. Its IUPAC name is ethane;5-[2-(1-fluoroethyl)-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine;2-methyloctane.
| Compound Name | ethane;5-[2-(1-fluoroethyl)-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine;2-methyloctane |
|---|---|
| PubChem CID | 167492858 |
| Molecular Formula | C29H41F4N3 |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | ethane;5-[2-(1-fluoroethyl)-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine;2-methyloctane |
| SMILES | CC.CC(F)c1cc(C(F)(F)F)ccc1C1=NCC=C(N)c2cnccc21.CCCCCCC(C)C |
| InChI | InChI=1S/C18H15F4N3.C9H20.C2H6/c1-10(19)14-8-11(18(20,21)22)2-3-12(14)17-13-4-6-24-9-15(13)16(23)5-7-25-17;1-4-5-6-7-8-9(2)3;1-2/h2-6,8-10H,7,23H2,1H3;9H,4-8H2,1-3H3;1-2H3 |
| InChIKey | XHSBDXVLZMUWCU-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|