About methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal
methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal (PubChem CID 167495938) has the molecular formula C18H19N3O5
and a molecular weight of 357.37 g/mol. Its IUPAC name is methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal.
Molecular Properties
| Compound Name | methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal |
| PubChem CID | 167495938 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal |
| SMILES | C=CC=O.CNc1ccc(Oc2ncc(C)cc2N=O)c(C(=O)OC)c1 |
| InChI | InChI=1S/C15H15N3O4.C3H4O/c1-9-6-12(18-20)14(17-8-9)22-13-5-4-10(16-2)7-11(13)15(19)21-3;1-2-3-4/h4-8,16H,1-3H3;2-3H,1H2 |
| InChIKey | KTWBDCXMSPNCFY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal?
The IUPAC name of methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal (CID 167495938) is methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal.
What is the SMILES notation for methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal?
The canonical SMILES for methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal is C=CC=O.CNc1ccc(Oc2ncc(C)cc2N=O)c(C(=O)OC)c1.
What is the InChIKey of methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal?
The InChIKey is KTWBDCXMSPNCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4.C3H4O/c1-9-6-12(18-20)14(17-8-9)22-13-5-4-10(16-2)7-11(13)15(19)21-3;1-2-3-4/h4-8,16H,1-3H3;2-3H,1H2.
What are the key properties of methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal?
methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal has a molecular weight of 357.37 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(methylamino)-2-[(5-methyl-3-nitroso-2-pyridinyl)oxy]benzoate;prop-2-enal is sourced from PubChem (CID 167495938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).