C22H28F4N6O2 — CID 167496813
N-[[(3Z)-3-[amino-(1-amino-2,2,2-trifluoroethoxy)methylidene]-2H-pyridin-6-yl]methyl]-4-ethyl-N-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 167496813) has the molecular formula C22H28F4N6O2 and a molecular weight of 484.50 g/mol. Its IUPAC name is N-[[(3Z)-3-[amino-(1-amino-2,2,2-trifluoroethoxy)methylidene]-2H-pyridin-6-yl]methyl]-4-ethyl-N-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-[[(3Z)-3-[amino-(1-amino-2,2,2-trifluoroethoxy)methylidene]-2H-pyridin-6-yl]methyl]-4-ethyl-N-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167496813 |
| Molecular Formula | C22H28F4N6O2 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-[[(3Z)-3-[amino-(1-amino-2,2,2-trifluoroethoxy)methylidene]-2H-pyridin-6-yl]methyl]-4-ethyl-N-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)N(CC2=NC/C(=C(/N)OC(N)C(F)(F)F)C=C2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H28F4N6O2/c1-2-30-9-11-31(12-10-30)21(33)32(18-7-4-16(23)5-8-18)14-17-6-3-15(13-29-17)19(27)34-20(28)22(24,25)26/h3-8,20H,2,9-14,27-28H2,1H3/b19-15- |
| InChIKey | JKZYXRWSIRJXOO-CYVLTUHYSA-N |
| XLogP | 2.43 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|