C23H21F4N5NiO4S — CID 167497019
[1-[[4-[[(1,1-dioxo-1,4-thiazinane-4-carbonyl)-(1-methylindazol-7-yl)amino]methyl]-3-fluorophenyl]methoxy]-2,2,2-trifluoroethylidene]azanide;nickel(2+) (PubChem CID 167497019) has the molecular formula C23H21F4N5NiO4S and a molecular weight of 598.20 g/mol. Its IUPAC name is [1-[[4-[[(1,1-dioxo-1,4-thiazinane-4-carbonyl)-(1-methylindazol-7-yl)amino]methyl]-3-fluorophenyl]methoxy]-2,2,2-trifluoroethylidene]azanide;nickel(2+).
| Compound Name | [1-[[4-[[(1,1-dioxo-1,4-thiazinane-4-carbonyl)-(1-methylindazol-7-yl)amino]methyl]-3-fluorophenyl]methoxy]-2,2,2-trifluoroethylidene]azanide;nickel(2+) |
|---|---|
| PubChem CID | 167497019 |
| Molecular Formula | C23H21F4N5NiO4S |
| Molecular Weight | 598.20 g/mol |
| Exact Mass | 597.06 |
| IUPAC Name | [1-[[4-[[(1,1-dioxo-1,4-thiazinane-4-carbonyl)-(1-methylindazol-7-yl)amino]methyl]-3-fluorophenyl]methoxy]-2,2,2-trifluoroethylidene]azanide;nickel(2+) |
| SMILES | Cn1ncc2cccc(N(Cc3ccc([CH-]OC(=[N-])C(F)(F)F)cc3F)C(=O)N3CCS(=O)(=O)CC3)c21.[Ni+2] |
| InChI | InChI=1S/C23H21F4N5O4S.Ni/c1-30-20-16(12-29-30)3-2-4-19(20)32(22(33)31-7-9-37(34,35)10-8-31)13-17-6-5-15(11-18(17)24)14-36-21(28)23(25,26)27;/h2-6,11-12,14H,7-10,13H2,1H3;/q-2;+2 |
| InChIKey | ZDQGQRUJBAZUKJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|