C24H22B3N3O5 — CID 167498460
CID 167498460 (PubChem CID 167498460) has the molecular formula C24H22B3N3O5 and a molecular weight of 464.89 g/mol.
| Compound Name | CID 167498460 |
|---|---|
| PubChem CID | 167498460 |
| Molecular Formula | C24H22B3N3O5 |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1ccccc1-c1c[nH]c(=O)c2cc(OC(C)C(=O)N3CCOC[C@H]3C(N)=O)ccc12 |
| InChI | InChI=1S/C24H22B3N3O5/c1-13(23(33)30-8-9-34-12-20(30)21(28)31)35-14-6-7-15-17(10-14)22(32)29-11-18(15)16-4-2-3-5-19(16)24(25,26)27/h2-7,10-11,13,20H,8-9,12H2,1H3,(H2,28,31)(H,29,32)/t13?,20-/m0/s1 |
| InChIKey | SGUUBHJOFJYLCN-JDOQCHFPSA-N |
| XLogP | 0.29 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|