C21H21NO4 — CID 167498735
3-[[4-(2,6-dimethylphenyl)-2-oxochromen-7-yl]amino]butanoic acid (PubChem CID 167498735) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)-2-oxochromen-7-yl]amino]butanoic acid.
| Compound Name | 3-[[4-(2,6-dimethylphenyl)-2-oxochromen-7-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 167498735 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)-2-oxochromen-7-yl]amino]butanoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(=O)oc2cc(NC(C)CC(=O)O)ccc12 |
| InChI | InChI=1S/C21H21NO4/c1-12-5-4-6-13(2)21(12)17-11-20(25)26-18-10-15(7-8-16(17)18)22-14(3)9-19(23)24/h4-8,10-11,14,22H,9H2,1-3H3,(H,23,24) |
| InChIKey | IOABHQRCPPLQBZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|