C28H37FN4O5 — CID 167499653
6-(4-fluorophenyl)-N-hexyl-4-hydroxy-1-(2-morpholin-4-ylethyl)-2-oxo-1,8-naphthyridine-3-carboxamide;methanol (PubChem CID 167499653) has the molecular formula C28H37FN4O5 and a molecular weight of 528.63 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-hexyl-4-hydroxy-1-(2-morpholin-4-ylethyl)-2-oxo-1,8-naphthyridine-3-carboxamide;methanol.
| Compound Name | 6-(4-fluorophenyl)-N-hexyl-4-hydroxy-1-(2-morpholin-4-ylethyl)-2-oxo-1,8-naphthyridine-3-carboxamide;methanol |
|---|---|
| PubChem CID | 167499653 |
| Molecular Formula | C28H37FN4O5 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 6-(4-fluorophenyl)-N-hexyl-4-hydroxy-1-(2-morpholin-4-ylethyl)-2-oxo-1,8-naphthyridine-3-carboxamide;methanol |
| SMILES | CCCCCCNC(=O)c1c(O)c2cc(-c3ccc(F)cc3)cnc2n(CCN2CCOCC2)c1=O.CO |
| InChI | InChI=1S/C27H33FN4O4.CH4O/c1-2-3-4-5-10-29-26(34)23-24(33)22-17-20(19-6-8-21(28)9-7-19)18-30-25(22)32(27(23)35)12-11-31-13-15-36-16-14-31;1-2/h6-9,17-18,33H,2-5,10-16H2,1H3,(H,29,34);2H,1H3 |
| InChIKey | CBOQZELAIDHSPI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|