C22H30N6O2 — CID 3746635
2-amino-1-(2-morpholin-4-ylethyl)-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 3746635) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-amino-1-(2-morpholin-4-ylethyl)-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-(2-morpholin-4-ylethyl)-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 3746635 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-amino-1-(2-morpholin-4-ylethyl)-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CCCCCNC(=O)c1c(N)n(CCN2CCOCC2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C22H30N6O2/c1-2-3-6-9-24-22(29)18-19-21(26-17-8-5-4-7-16(17)25-19)28(20(18)23)11-10-27-12-14-30-15-13-27/h4-5,7-8H,2-3,6,9-15,23H2,1H3,(H,24,29) |
| InChIKey | JQKASEWSZTVVJE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|