C25H28ClN5O — CID 2038481
2-amino-1-(3-chloro-4-methylphenyl)-N-heptylpyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 2038481) has the molecular formula C25H28ClN5O and a molecular weight of 449.99 g/mol. Its IUPAC name is 2-amino-1-(3-chloro-4-methylphenyl)-N-heptylpyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-(3-chloro-4-methylphenyl)-N-heptylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 2038481 |
| Molecular Formula | C25H28ClN5O |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-amino-1-(3-chloro-4-methylphenyl)-N-heptylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CCCCCCCNC(=O)c1c(N)n(-c2ccc(C)c(Cl)c2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C25H28ClN5O/c1-3-4-5-6-9-14-28-25(32)21-22-24(30-20-11-8-7-10-19(20)29-22)31(23(21)27)17-13-12-16(2)18(26)15-17/h7-8,10-13,15H,3-6,9,14,27H2,1-2H3,(H,28,32) |
| InChIKey | VJGCUXAZTIJLFZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|