C25H29N7O2 — CID 23905948
2-amino-1-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 23905948) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-amino-1-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 23905948 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-amino-1-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-ylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CN(C)c1ccc(-n2c(N)c(C(=O)NCCN3CCOCC3)c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C25H29N7O2/c1-30(2)17-7-9-18(10-8-17)32-23(26)21(25(33)27-11-12-31-13-15-34-16-14-31)22-24(32)29-20-6-4-3-5-19(20)28-22/h3-10H,11-16,26H2,1-2H3,(H,27,33) |
| InChIKey | IQKQAAGCOQNCOT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|