C25H28FN7O2 — CID 167501775
4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-ethyl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)indazole-7-carboxamide (PubChem CID 167501775) has the molecular formula C25H28FN7O2 and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-ethyl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)indazole-7-carboxamide.
| Compound Name | 4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-ethyl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)indazole-7-carboxamide |
|---|---|
| PubChem CID | 167501775 |
| Molecular Formula | C25H28FN7O2 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-ethyl-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)indazole-7-carboxamide |
| SMILES | CCn1cc2c(N3CCN4CCOC[C@H]4C3)ccc(C(=O)Nc3cc(F)c4nc(C)cn4c3)c2n1 |
| InChI | InChI=1S/C25H28FN7O2/c1-3-33-14-20-22(31-7-6-30-8-9-35-15-18(30)13-31)5-4-19(23(20)29-33)25(34)28-17-10-21(26)24-27-16(2)11-32(24)12-17/h4-5,10-12,14,18H,3,6-9,13,15H2,1-2H3,(H,28,34)/t18-/m1/s1 |
| InChIKey | BAMNRNVPIXESAY-GOSISDBHSA-N |
| XLogP | 2.92 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |