C18H15BFN5O — CID 167501346
CID 167501346 (PubChem CID 167501346) has the molecular formula C18H15BFN5O and a molecular weight of 347.16 g/mol.
| Compound Name | CID 167501346 |
|---|---|
| PubChem CID | 167501346 |
| Molecular Formula | C18H15BFN5O |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)Nc2cc(F)c3nc(C)cn3c2)c2nn(CC)cc12 |
| InChI | InChI=1S/C18H15BFN5O/c1-3-25-9-13-14(19)5-4-12(16(13)23-25)18(26)22-11-6-15(20)17-21-10(2)7-24(17)8-11/h4-9H,3H2,1-2H3,(H,22,26) |
| InChIKey | VGLMSNFJJAOJHV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|