C18H13BFN5O — CID 167500186
CID 167500186 (PubChem CID 167500186) has the molecular formula C18H13BFN5O and a molecular weight of 345.15 g/mol.
| Compound Name | CID 167500186 |
|---|---|
| PubChem CID | 167500186 |
| Molecular Formula | C18H13BFN5O |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)Nc2cc(F)c3nc(C)cn3c2)c2ncc(C)nc12 |
| InChI | InChI=1S/C18H13BFN5O/c1-9-6-21-15-12(3-4-13(19)16(15)22-9)18(26)24-11-5-14(20)17-23-10(2)7-25(17)8-11/h3-8H,1-2H3,(H,24,26) |
| InChIKey | CUWOTQLVYWIXIG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|