C13H8BF2N3OS — CID 156845164
CID 156845164 (PubChem CID 156845164) has the molecular formula C13H8BF2N3OS and a molecular weight of 303.10 g/mol.
| Compound Name | CID 156845164 |
|---|---|
| PubChem CID | 156845164 |
| Molecular Formula | C13H8BF2N3OS |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c(C(=O)Nc2cc(F)c3nc(C)cn3c2)s1 |
| InChI | InChI=1S/C13H8BF2N3OS/c1-6-4-19-5-7(2-9(16)12(19)17-6)18-13(20)11-8(15)3-10(14)21-11/h2-5H,1H3,(H,18,20) |
| InChIKey | UWRJTMDDDGJOGM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|