C17H21BFNO3S — CID 167503644
5-[2-fluoro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,3-thiazole (PubChem CID 167503644) has the molecular formula C17H21BFNO3S and a molecular weight of 349.24 g/mol. Its IUPAC name is 5-[2-fluoro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[2-fluoro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 167503644 |
| Molecular Formula | C17H21BFNO3S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 5-[2-fluoro-5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,3-thiazole |
| SMILES | COc1cc(-c2cnc(C)s2)c(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H21BFNO3S/c1-10-20-9-15(24-10)11-7-14(21-6)12(8-13(11)19)18-22-16(2,3)17(4,5)23-18/h7-9H,1-6H3 |
| InChIKey | VFWQVWRWWAIWCP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|