C29H24N4O5 — CID 167505733
methyl 3-[3-[2-[3-[[4-(hydroxyiminomethyl)-1H-indol-5-yl]oxy]phenyl]-1H-imidazole-5-carbonyl]phenyl]propanoate (PubChem CID 167505733) has the molecular formula C29H24N4O5 and a molecular weight of 508.53 g/mol. Its IUPAC name is methyl 3-[3-[2-[3-[[4-(hydroxyiminomethyl)-1H-indol-5-yl]oxy]phenyl]-1H-imidazole-5-carbonyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[2-[3-[[4-(hydroxyiminomethyl)-1H-indol-5-yl]oxy]phenyl]-1H-imidazole-5-carbonyl]phenyl]propanoate |
|---|---|
| PubChem CID | 167505733 |
| Molecular Formula | C29H24N4O5 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | methyl 3-[3-[2-[3-[[4-(hydroxyiminomethyl)-1H-indol-5-yl]oxy]phenyl]-1H-imidazole-5-carbonyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cccc(C(=O)c2cnc(-c3cccc(Oc4ccc5[nH]ccc5c4C=NO)c3)[nH]2)c1 |
| InChI | InChI=1S/C29H24N4O5/c1-37-27(34)11-8-18-4-2-5-19(14-18)28(35)25-17-31-29(33-25)20-6-3-7-21(15-20)38-26-10-9-24-22(12-13-30-24)23(26)16-32-36/h2-7,9-10,12-17,30,36H,8,11H2,1H3,(H,31,33) |
| InChIKey | MLNBFDDISYXRAH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|