C17H16ClNO3S — CID 167506965
5-(4-cyclopropylphenyl)-3-ethylsulfonylpyridine-2-carbonyl chloride (PubChem CID 167506965) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is 5-(4-cyclopropylphenyl)-3-ethylsulfonylpyridine-2-carbonyl chloride.
| Compound Name | 5-(4-cyclopropylphenyl)-3-ethylsulfonylpyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 167506965 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 5-(4-cyclopropylphenyl)-3-ethylsulfonylpyridine-2-carbonyl chloride |
| SMILES | CCS(=O)(=O)c1cc(-c2ccc(C3CC3)cc2)cnc1C(=O)Cl |
| InChI | InChI=1S/C17H16ClNO3S/c1-2-23(21,22)15-9-14(10-19-16(15)17(18)20)13-7-5-12(6-8-13)11-3-4-11/h5-11H,2-4H2,1H3 |
| InChIKey | JXJHZSDKKOBKFB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|