C22H28O3S — CID 89360213
5-(4-ethylcyclohexyl)-2-(4-ethylphenyl)benzenesulfonic acid (PubChem CID 89360213) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 5-(4-ethylcyclohexyl)-2-(4-ethylphenyl)benzenesulfonic acid.
| Compound Name | 5-(4-ethylcyclohexyl)-2-(4-ethylphenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89360213 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 5-(4-ethylcyclohexyl)-2-(4-ethylphenyl)benzenesulfonic acid |
| SMILES | CCc1ccc(-c2ccc(C3CCC(CC)CC3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-3-16-5-9-18(10-6-16)20-13-14-21(22(15-20)26(23,24)25)19-11-7-17(4-2)8-12-19/h7-8,11-16,18H,3-6,9-10H2,1-2H3,(H,23,24,25) |
| InChIKey | QVBIXMGOWAUXQD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|