C32H45ClN2O3 — CID 167510278
(2R,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R)-4-(6-chloroquinazolin-2-yl)butan-2-yl]-2,15-dimethyltetracyclo[8.7.1.02,7.011,15]octadecane-5,9,16-triol (PubChem CID 167510278) has the molecular formula C32H45ClN2O3 and a molecular weight of 541.18 g/mol. Its IUPAC name is (2R,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R)-4-(6-chloroquinazolin-2-yl)butan-2-yl]-2,15-dimethyltetracyclo[8.7.1.02,7.011,15]octadecane-5,9,16-triol.
| Compound Name | (2R,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R)-4-(6-chloroquinazolin-2-yl)butan-2-yl]-2,15-dimethyltetracyclo[8.7.1.02,7.011,15]octadecane-5,9,16-triol |
|---|---|
| PubChem CID | 167510278 |
| Molecular Formula | C32H45ClN2O3 |
| Molecular Weight | 541.18 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (2R,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R)-4-(6-chloroquinazolin-2-yl)butan-2-yl]-2,15-dimethyltetracyclo[8.7.1.02,7.011,15]octadecane-5,9,16-triol |
| SMILES | C[C@H](CCc1ncc2cc(Cl)ccc2n1)[C@H]1CC[C@H]2[C@H]3CC(C[C@H](O)[C@]12C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O |
| InChI | InChI=1S/C32H45ClN2O3/c1-18(4-9-30-34-17-19-12-22(33)5-8-27(19)35-30)25-6-7-26-24-14-21(16-29(38)32(25,26)3)31(2)11-10-23(36)13-20(31)15-28(24)37/h5,8,12,17-18,20-21,23-26,28-29,36-38H,4,6-7,9-11,13-16H2,1-3H3/t18-,20+,21?,23-,24-,25-,26+,28-,29+,31+,32-/m1/s1 |
| InChIKey | YIZBOLORDAPELS-GIFWSITRSA-N |
| XLogP | 6.20 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.18 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |