C31H44N2O3 — CID 167510436
2-[3-[(3R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-8-methyl-3H-quinazolin-4-one (PubChem CID 167510436) has the molecular formula C31H44N2O3 and a molecular weight of 492.70 g/mol. Its IUPAC name is 2-[3-[(3R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-8-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[3-[(3R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-8-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167510436 |
| Molecular Formula | C31H44N2O3 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 2-[3-[(3R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-8-methyl-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CCCC3CCC4C5C(O)CC6C[C@H](O)CCC6(C)C5CCC34C)nc12 |
| InChI | InChI=1S/C31H44N2O3/c1-18-6-4-8-22-28(18)32-26(33-29(22)36)9-5-7-19-10-11-23-27-24(13-15-30(19,23)2)31(3)14-12-21(34)16-20(31)17-25(27)35/h4,6,8,19-21,23-25,27,34-35H,5,7,9-17H2,1-3H3,(H,32,33,36)/t19?,20?,21-,23?,24?,25?,27?,30?,31?/m1/s1 |
| InChIKey | HRUYAKKDNWCPLK-DOTPGRFGSA-N |
| XLogP | 5.54 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |