C33H56BClNO5 — CID 177224949
CID 177224949 (PubChem CID 177224949) has the molecular formula C33H56BClNO5 and a molecular weight of 593.08 g/mol.
| Compound Name | CID 177224949 |
|---|---|
| PubChem CID | 177224949 |
| Molecular Formula | C33H56BClNO5 |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N(CCCCC1CC[C@@H]2C3C(O)C[C@@H]4C[C@H](O)CCC4(C)C3CCC12C)CCCC(=O)[B]CCl |
| InChI | InChI=1S/C33H56BClNO5/c1-31(2,3)41-30(40)36(18-8-10-28(39)34-21-35)17-7-6-9-22-11-12-25-29-26(14-16-32(22,25)4)33(5)15-13-24(37)19-23(33)20-27(29)38/h22-27,29,37-38H,6-21H2,1-5H3/t22?,23-,24+,25+,26?,27?,29?,32?,33?/m0/s1 |
| InChIKey | NGORZDLGBVJZGV-YBAOOGPQSA-N |
| XLogP | 6.59 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|