C29H49NO5 — CID 174269441
tert-butyl 5-[4-hydroxy-7-(2-hydroxyacetyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl]pentanoate (PubChem CID 174269441) has the molecular formula C29H49NO5 and a molecular weight of 491.71 g/mol. Its IUPAC name is tert-butyl 5-[4-hydroxy-7-(2-hydroxyacetyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl]pentanoate.
| Compound Name | tert-butyl 5-[4-hydroxy-7-(2-hydroxyacetyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl]pentanoate |
|---|---|
| PubChem CID | 174269441 |
| Molecular Formula | C29H49NO5 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | tert-butyl 5-[4-hydroxy-7-(2-hydroxyacetyl)-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCC1CCC2C3C(O)CC4CN(C(=O)CO)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H49NO5/c1-27(2,3)35-25(34)9-7-6-8-19-10-11-21-26-22(12-13-28(19,21)4)29(5)14-15-30(24(33)18-31)17-20(29)16-23(26)32/h19-23,26,31-32H,6-18H2,1-5H3 |
| InChIKey | WRAFJPWXHHELOL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|