C25H44N2O3S — CID 174269798
5-[(4S)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]-N-(2-hydroxysulfanylethyl)pentanamide (PubChem CID 174269798) has the molecular formula C25H44N2O3S and a molecular weight of 452.71 g/mol. Its IUPAC name is 5-[(4S)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]-N-(2-hydroxysulfanylethyl)pentanamide.
| Compound Name | 5-[(4S)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]-N-(2-hydroxysulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 174269798 |
| Molecular Formula | C25H44N2O3S |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 5-[(4S)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]-N-(2-hydroxysulfanylethyl)pentanamide |
| SMILES | CC12CCC3C(C(O)CC4CNCCC43C)C1CCC2CCCCC(=O)NCCSO |
| InChI | InChI=1S/C25H44N2O3S/c1-24-10-9-20-23(21(28)15-18-16-26-12-11-25(18,20)2)19(24)8-7-17(24)5-3-4-6-22(29)27-13-14-31-30/h17-21,23,26,28,30H,3-16H2,1-2H3,(H,27,29) |
| InChIKey | PYJWIEOHTSZVAQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|