C23H24N2O2 — CID 16751393
2-[(2S,6S)-6-(2-hydroxyphenyl)-1-(pyridin-2-ylmethyl)piperidin-2-yl]phenol (PubChem CID 16751393) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[(2S,6S)-6-(2-hydroxyphenyl)-1-(pyridin-2-ylmethyl)piperidin-2-yl]phenol.
| Compound Name | 2-[(2S,6S)-6-(2-hydroxyphenyl)-1-(pyridin-2-ylmethyl)piperidin-2-yl]phenol |
|---|---|
| PubChem CID | 16751393 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[(2S,6S)-6-(2-hydroxyphenyl)-1-(pyridin-2-ylmethyl)piperidin-2-yl]phenol |
| SMILES | Oc1ccccc1[C@@H]1CCC[C@@H](c2ccccc2O)N1Cc1ccccn1 |
| InChI | InChI=1S/C23H24N2O2/c26-22-13-3-1-9-18(22)20-11-7-12-21(19-10-2-4-14-23(19)27)25(20)16-17-8-5-6-15-24-17/h1-6,8-10,13-15,20-21,26-27H,7,11-12,16H2/t20-,21-/m0/s1 |
| InChIKey | ISVCPLLLNDUYCS-SFTDATJTSA-N |
| XLogP | 4.96 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|