C15H13FN2O — CID 16751733
6-(3-fluorophenyl)-3,3-dimethylimidazo[1,2-a]pyridin-2-one (PubChem CID 16751733) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-3,3-dimethylimidazo[1,2-a]pyridin-2-one.
| Compound Name | 6-(3-fluorophenyl)-3,3-dimethylimidazo[1,2-a]pyridin-2-one |
|---|---|
| PubChem CID | 16751733 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 6-(3-fluorophenyl)-3,3-dimethylimidazo[1,2-a]pyridin-2-one |
| SMILES | CC1(C)C(=O)N=C2C=CC(c3cccc(F)c3)=CN21 |
| InChI | InChI=1S/C15H13FN2O/c1-15(2)14(19)17-13-7-6-11(9-18(13)15)10-4-3-5-12(16)8-10/h3-9H,1-2H3 |
| InChIKey | ZZFVPPIVEYTFET-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |