C9H7FN2O — CID 174470166
3-(3-fluorophenyl)-1,5-dihydropyrazol-4-one (PubChem CID 174470166) has the molecular formula C9H7FN2O and a molecular weight of 178.17 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,5-dihydropyrazol-4-one.
| Compound Name | 3-(3-fluorophenyl)-1,5-dihydropyrazol-4-one |
|---|---|
| PubChem CID | 174470166 |
| Molecular Formula | C9H7FN2O |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-(3-fluorophenyl)-1,5-dihydropyrazol-4-one |
| SMILES | O=C1CNN=C1c1cccc(F)c1 |
| InChI | InChI=1S/C9H7FN2O/c10-7-3-1-2-6(4-7)9-8(13)5-11-12-9/h1-4,11H,5H2 |
| InChIKey | DAPUCFAUMVZYKI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |