C12H12FN3OS — CID 66966388
4-(3-fluorophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one (PubChem CID 66966388) has the molecular formula C12H12FN3OS and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one.
| Compound Name | 4-(3-fluorophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one |
|---|---|
| PubChem CID | 66966388 |
| Molecular Formula | C12H12FN3OS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-(3-fluorophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one |
| SMILES | O=C1NN=C(c2cccc(F)c2)N2CCSCC12 |
| InChI | InChI=1S/C12H12FN3OS/c13-9-3-1-2-8(6-9)11-14-15-12(17)10-7-18-5-4-16(10)11/h1-3,6,10H,4-5,7H2,(H,15,17) |
| InChIKey | FTSOXHODPNWZDM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |