C12H12N4O3S — CID 66965379
4-(4-nitrophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one (PubChem CID 66965379) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one.
| Compound Name | 4-(4-nitrophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one |
|---|---|
| PubChem CID | 66965379 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-(4-nitrophenyl)-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one |
| SMILES | O=C1NN=C(c2ccc([N+](=O)[O-])cc2)N2CCSCC12 |
| InChI | InChI=1S/C12H12N4O3S/c17-12-10-7-20-6-5-15(10)11(13-14-12)8-1-3-9(4-2-8)16(18)19/h1-4,10H,5-7H2,(H,14,17) |
| InChIKey | HWGMVPAPVBESAL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|