C21H31N5O6S2 — CID 87217741
methanesulfonic acid;4-morpholin-4-yl-N-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]butanamide (PubChem CID 87217741) has the molecular formula C21H31N5O6S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is methanesulfonic acid;4-morpholin-4-yl-N-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]butanamide.
| Compound Name | methanesulfonic acid;4-morpholin-4-yl-N-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 87217741 |
| Molecular Formula | C21H31N5O6S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | methanesulfonic acid;4-morpholin-4-yl-N-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]butanamide |
| SMILES | CS(=O)(=O)O.O=C(CCCN1CCOCC1)Nc1cccc(C2=NNC(=O)C3CSCCN23)c1 |
| InChI | InChI=1S/C20H27N5O3S.CH4O3S/c26-18(5-2-6-24-7-10-28-11-8-24)21-16-4-1-3-15(13-16)19-22-23-20(27)17-14-29-12-9-25(17)19;1-5(2,3)4/h1,3-4,13,17H,2,5-12,14H2,(H,21,26)(H,23,27);1H3,(H,2,3,4) |
| InChIKey | MARHTRNPFJXSRT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|