C26H31N5O4S — CID 66966374
benzyl N-methyl-N-[5-oxo-5-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)anilino]pentyl]carbamate (PubChem CID 66966374) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is benzyl N-methyl-N-[5-oxo-5-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)anilino]pentyl]carbamate.
| Compound Name | benzyl N-methyl-N-[5-oxo-5-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)anilino]pentyl]carbamate |
|---|---|
| PubChem CID | 66966374 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | benzyl N-methyl-N-[5-oxo-5-[3-(1-oxo-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)anilino]pentyl]carbamate |
| SMILES | CN(CCCCC(=O)Nc1cccc(C2=NNC(=O)C3CSCCN23)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31N5O4S/c1-30(26(34)35-17-19-8-3-2-4-9-19)13-6-5-12-23(32)27-21-11-7-10-20(16-21)24-28-29-25(33)22-18-36-15-14-31(22)24/h2-4,7-11,16,22H,5-6,12-15,17-18H2,1H3,(H,27,32)(H,29,33) |
| InChIKey | XWGRHYSXOTXOPJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|