C31H32N4O5 — CID 23449718
benzyl N-(oxolan-3-yl)-N-[5-oxo-5-[3-(4-oxo-3H-phthalazin-1-yl)anilino]pentyl]carbamate (PubChem CID 23449718) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is benzyl N-(oxolan-3-yl)-N-[5-oxo-5-[3-(4-oxo-3H-phthalazin-1-yl)anilino]pentyl]carbamate.
| Compound Name | benzyl N-(oxolan-3-yl)-N-[5-oxo-5-[3-(4-oxo-3H-phthalazin-1-yl)anilino]pentyl]carbamate |
|---|---|
| PubChem CID | 23449718 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | benzyl N-(oxolan-3-yl)-N-[5-oxo-5-[3-(4-oxo-3H-phthalazin-1-yl)anilino]pentyl]carbamate |
| SMILES | O=C(CCCCN(C(=O)OCc1ccccc1)C1CCOC1)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C31H32N4O5/c36-28(32-24-12-8-11-23(19-24)29-26-13-4-5-14-27(26)30(37)34-33-29)15-6-7-17-35(25-16-18-39-21-25)31(38)40-20-22-9-2-1-3-10-22/h1-5,8-14,19,25H,6-7,15-18,20-21H2,(H,32,36)(H,34,37) |
| InChIKey | MHFUHUXURIMHPK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|