C27H24N4O4 — CID 23449753
benzyl N-[[2-[[3-(4-oxo-3H-phthalazin-1-yl)phenyl]carbamoyl]cyclopropyl]methyl]carbamate (PubChem CID 23449753) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is benzyl N-[[2-[[3-(4-oxo-3H-phthalazin-1-yl)phenyl]carbamoyl]cyclopropyl]methyl]carbamate.
| Compound Name | benzyl N-[[2-[[3-(4-oxo-3H-phthalazin-1-yl)phenyl]carbamoyl]cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 23449753 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | benzyl N-[[2-[[3-(4-oxo-3H-phthalazin-1-yl)phenyl]carbamoyl]cyclopropyl]methyl]carbamate |
| SMILES | O=C(NCC1CC1C(=O)Nc1cccc(-c2n[nH]c(=O)c3ccccc23)c1)OCc1ccccc1 |
| InChI | InChI=1S/C27H24N4O4/c32-25(23-14-19(23)15-28-27(34)35-16-17-7-2-1-3-8-17)29-20-10-6-9-18(13-20)24-21-11-4-5-12-22(21)26(33)31-30-24/h1-13,19,23H,14-16H2,(H,28,34)(H,29,32)(H,31,33) |
| InChIKey | WBPZRYGLABJAHX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |