C26H24N4O3 — CID 142651575
benzyl N-[4-[3-(4-oxo-3H-phthalazin-1-yl)anilino]but-3-enyl]carbamate (PubChem CID 142651575) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is benzyl N-[4-[3-(4-oxo-3H-phthalazin-1-yl)anilino]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[3-(4-oxo-3H-phthalazin-1-yl)anilino]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 142651575 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | benzyl N-[4-[3-(4-oxo-3H-phthalazin-1-yl)anilino]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=CNc1cccc(-c2n[nH]c(=O)c3ccccc23)c1)OCc1ccccc1 |
| InChI | InChI=1S/C26H24N4O3/c31-25-23-14-5-4-13-22(23)24(29-30-25)20-11-8-12-21(17-20)27-15-6-7-16-28-26(32)33-18-19-9-2-1-3-10-19/h1-6,8-15,17,27H,7,16,18H2,(H,28,32)(H,30,31) |
| InChIKey | YXJGONVATMDJLM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|