C18H24ClN5O2S — CID 66966010
5-(methylamino)-N-[3-(1-oxo-6,7-dihydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]pentanamide;hydrochloride (PubChem CID 66966010) has the molecular formula C18H24ClN5O2S and a molecular weight of 409.94 g/mol. Its IUPAC name is 5-(methylamino)-N-[3-(1-oxo-6,7-dihydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]pentanamide;hydrochloride.
| Compound Name | 5-(methylamino)-N-[3-(1-oxo-6,7-dihydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 66966010 |
| Molecular Formula | C18H24ClN5O2S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-(methylamino)-N-[3-(1-oxo-6,7-dihydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-4-yl)phenyl]pentanamide;hydrochloride |
| SMILES | CNCCCCC(=O)Nc1cccc(C2=NNC(=O)C3=CSCCN32)c1.Cl |
| InChI | InChI=1S/C18H23N5O2S.ClH/c1-19-8-3-2-7-16(24)20-14-6-4-5-13(11-14)17-21-22-18(25)15-12-26-10-9-23(15)17;/h4-6,11-12,19H,2-3,7-10H2,1H3,(H,20,24)(H,22,25);1H |
| InChIKey | XRIQZPINVLDCND-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|