C22H26N4O2 — CID 139905676
N-[3-(3,4-dihydrophthalazin-1-yl)phenyl]-4-morpholin-4-ylbutanamide (PubChem CID 139905676) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[3-(3,4-dihydrophthalazin-1-yl)phenyl]-4-morpholin-4-ylbutanamide.
| Compound Name | N-[3-(3,4-dihydrophthalazin-1-yl)phenyl]-4-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 139905676 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[3-(3,4-dihydrophthalazin-1-yl)phenyl]-4-morpholin-4-ylbutanamide |
| SMILES | O=C(CCCN1CCOCC1)Nc1cccc(C2=NNCc3ccccc32)c1 |
| InChI | InChI=1S/C22H26N4O2/c27-21(9-4-10-26-11-13-28-14-12-26)24-19-7-3-6-17(15-19)22-20-8-2-1-5-18(20)16-23-25-22/h1-3,5-8,15,23H,4,9-14,16H2,(H,24,27) |
| InChIKey | BJIFTRQWWNFQLY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |